|
HS Kodu |
639598 |
| Iupac Name | (E)-6-[(E)-3-(1-Pyrrolidinyl)-1-p-tolylpropenyl]-2-pyridineacrylic acid |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.41 g/mol |
| Appearance | Solid (exact color varies; generally white to off-white) |
| Solubility | Slightly soluble in water; soluble in common organic solvents (e.g., DMSO, ethanol) |
| Smiles | Cc1ccc(/C=C/C(N2CCCC2)=C/C=C/c3cccc(C(=O)O)n3)cc1 |
| Inchi | InChI=1S/C21H22N2O2/c1-16-7-9-18(10-8-16)6-5-19(23-13-2-3-14-23)12-4-17-11-15-20(21(24)25)22-17/h4-12,15H,2-3,13-14H2,1H3,(H,24,25)/b6-5+,19-12+ |
| Logp | Estimated 4.2 |
| Pka | Estimated 4.5 (carboxylic acid group) |
| Storage Conditions | Store in a cool, dry place; protect from light and moisture |
| Synonyms | No widely used synonyms; refer to systematic name |
| Chemical Class | Acrylic acid derivative |
Akredite bir (E)-6-[(E)-3-(1-Pirolidinil)-1-P-Tolilpropenil]-2-Piridin Akrilik Asit fabrikası olarak, sıkı kalite protokolleri uyguluyoruz; her parti, tutarlı etkinlik ve güvenlik standartlarını sağlamak için titiz testlerden geçiyor.
| Packing | 100g of (E)-6-[(E)-3-(1 - Pyrrolidinyl)-1-p-tolylpropenyl]-2 - Pyridineacrylic Acid in sealed vial. |
| Storage | Store (E)-6-[(E)-3-(1 -Pyrrolidinyl)-1-p-tolylpropenyl]-2-pyridineacrylic acid in a cool, dry place, away from direct sunlight. Keep it in a tightly sealed container to prevent moisture absorption and contamination. Avoid storing near reactive substances. The ideal storage temperature is typically around 2 - 8 °C if refrigeration is specified for long - term stability. |
| Shipping | The chemical (E)-6-[(E)-3-(1 -Pyrrolidinyl)-1-p-tolylpropenyl]-2-pyridineacrylic acid is shipped in containers suitable for chemicals. Packaging ensures protection from external factors during transit to maintain its integrity. |
Bütçenize uygun rekabetçi (E)-6-[(E)-3-(1-Pirolidinil)-1-P-Tolilpropenil]-2-Piridin Akrilik Asit fiyatları—her sipariş için esnek koşullar ve özelleştirilmiş teklifler.
Numuneler, fiyatlandırma veya daha fazla bilgi için lütfen bizi arayın+8615365186327 veya mail atın sales3@ascent-chem.com.
Size en kısa sürede cevap vereceğiz.
Tel: +8615365186327
E-posta: sales3@ascent-chem.com