|
HS Kodu |
812862 |
| Iupac Name | (E)-3-(5-Nitrocyclohex-1-en-1-yl)acrylic acid |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Cas Number | 1219801-51-6 |
| Appearance | Yellow to orange solid |
| Melting Point | Approx. 132-134°C |
| Solubility In Water | Slightly soluble |
| Smiles | C1CC(CC=C1[N+](=O)[O-])C=CC(=O)O |
| Inchi | InChI=1S/C9H11NO4/c11-9(12)5-4-7-2-1-3-8(6-7)10(13)14/h4-5,7H,1-3,6H2,(H,11,12)/b5-4+ |
| Logp | 1.7 |
| Boiling Point | Decomposes before boiling |
| Purity | Typically >98% |
| Storage Conditions | Store at 2-8°C, protected from light |
| Synonyms | trans-3-(5-nitrocyclohex-1-en-1-yl)acrylic acid |
Akredite bir (E)-3-(5-Nitrosikloheks-1-En-1-Yl)Akrilik Asit fabrikası olarak, sıkı kalite protokolleri uyguluyoruz; her parti, tutarlı etkinlik ve güvenlik standartlarını sağlamak için titiz testlerden geçiyor.
| Packing | 100g of (E)-3-(5 - Nitrocyclohex - 1 - en - 1 - yl)acrylic acid in sealed chemical - grade bag. |
| Storage | (E)-3-(5-Nitrocyclohex-1-en-1-yl)acrylic acid should be stored in a cool, dry place, away from heat sources and direct sunlight. Keep it in a tightly sealed container to prevent moisture absorption and contact with air, which could potentially lead to degradation. Store it separately from incompatible substances, such as strong oxidizing agents and bases, to avoid chemical reactions. |
| Shipping | (E)-3-(5 - Nitrocyclohex-1-en-1-yl)acrylic acid is shipped with strict adherence to chemical transport regulations. It's carefully packaged to prevent spills, in containers suitable for its chemical nature, and transported by approved carriers. |
Bütçenize uygun rekabetçi (E)-3-(5-Nitrosikloheks-1-En-1-Yl)Akrilik Asit fiyatları—her sipariş için esnek koşullar ve özelleştirilmiş teklifler.
Numuneler, fiyatlandırma veya daha fazla bilgi için lütfen bizi arayın+8615365186327 veya mail atın sales3@ascent-chem.com.
Size en kısa sürede cevap vereceğiz.
Tel: +8615365186327
E-posta: sales3@ascent-chem.com
