|
HS Kodu |
230815 |
| Productname | Acrylic Acid 6-(4-Hydroxy-Phenoxy)-Hexyl Ester |
| Molecularformula | C15H20O4 |
| Molecularweight | 264.32 g/mol |
| Casnumber | 153167-82-5 |
| Appearance | Colorless to light yellow liquid |
| Purity | ≥98% |
| Density | Approx. 1.15 g/cm³ |
| Solubility | Soluble in organic solvents |
| Functionalgroups | Acrylic ester, phenol |
| Storagetemperature | 2-8°C |
| Refractiveindex | Approx. 1.523 |
| Flashpoint | >110°C |
| Smiles | C=CC(=O)OCCCCCCOc1ccc(O)cc1 |
Akredite bir Akrilik Asit 6-(4-Hidroksi-Fenoksi)-Heksil Ester fabrikası olarak, sıkı kalite protokolleri uyguluyoruz; her parti, tutarlı etkinlik ve güvenlik standartlarını sağlamak için titiz testlerden geçiyor.
| Packing | 500g of Acrylic Acid 6-(4-Hydroxy - Phenoxy) - Hexyl Ester in air - tight, labeled containers. |
| Storage | "Acrylic Acid 6-(4-Hydroxy-Phenoxy) -Hexyl Ester" should be stored in a cool, dry place away from heat and ignition sources. Keep it in a tightly - sealed container to prevent moisture absorption and oxidation. Store separately from incompatible substances like strong oxidizers, bases, and amines to avoid potential chemical reactions. |
| Shipping | Acrylic Acid 6-(4-Hydroxy-Phenoxy) -Hexyl Ester is shipped in containers suitable for chemicals. Packaging ensures protection from external factors. Shipment follows strict safety regulations for handling and transporting this chemical. |
Bütçenize uygun rekabetçi Akrilik Asit 6-(4-Hidroksi-Fenoksi)-Heksil Ester fiyatları—her sipariş için esnek koşullar ve özelleştirilmiş teklifler.
Numuneler, fiyatlandırma veya daha fazla bilgi için lütfen bizi arayın+8615365186327 veya mail atın sales3@ascent-chem.com.
Size en kısa sürede cevap vereceğiz.
Tel: +8615365186327
E-posta: sales3@ascent-chem.com
