|
HS Kodu |
582074 |
| Productname | Acrylic Acid 2,2,3,3,4,4,5,5-Octafluoropentyl Ester~1H,1H,5H-Perfluoro-1-Pentyl Acrylate |
| Casnumber | 87048-35-5 |
| Molecularformula | C8H6F8O2 |
| Molecularweight | 282.12 |
| Appearance | Colorless liquid |
| Boilingpoint | 108-110°C at 13 mmHg |
| Density | 1.43 g/cm3 |
| Refractiveindex | n20/D 1.355 |
| Flashpoint | >110°C |
| Solubility | Insoluble in water |
| Purity | Typically ≥98% |
| Storagetemperature | 2-8°C |
| Smiles | C=CC(=O)OCCCC(C(F)(F)C(F)(F)F)F |
| Inchikey | QIWJQNGQQOIATQ-UHFFFAOYSA-N |
Akredite bir Akrilik Asit 2,2,3,3,4,4,5,5-Oktafloropentil Ester~1H,1H,5H-Perfloro-1-Pentil Akrilat fabrikası olarak, sıkı kalite protokolleri uyguluyoruz; her parti, tutarlı etkinlik ve güvenlik standartlarını sağlamak için titiz testlerden geçiyor.
| Packing | 500g of Acrylic Acid 2,2,3,3,4,4,5,5 - Octafluoropentyl Ester in sealed, labeled container. |
| Storage | Store "Acrylic Acid 2,2,3,3,4,4,5,5 - Octafluoropentyl Ester~1H,1H,5H - Perfluoro - 1 - Pentyl Acrylate" in a cool, well - ventilated area away from heat, sparks, and open flames. Keep it in a tightly - sealed container to prevent vapor release. Store separately from oxidizing agents and incompatible substances to avoid potential reactions. |
| Shipping | Acrylic Acid 2,2,3,3,4,4,5,5 - Octafluoropentyl Ester ~ 1H,1H,5H - Perfluoro - 1 - Pentyl Acrylate is shipped in specialized containers, ensuring proper containment and safety, compliant with chemical transportation regulations. |
Bütçenize uygun rekabetçi Akrilik Asit 2,2,3,3,4,4,5,5-Oktafloropentil Ester~1H,1H,5H-Perfloro-1-Pentil Akrilat fiyatları—her sipariş için esnek koşullar ve özelleştirilmiş teklifler.
Numuneler, fiyatlandırma veya daha fazla bilgi için lütfen bizi arayın+8615365186327 veya mail atın sales3@ascent-chem.com.
Size en kısa sürede cevap vereceğiz.
Tel: +8615365186327
E-posta: sales3@ascent-chem.com