|
HS Kodu |
936910 |
| Product Name | 3B-Indole Acrylic Acid |
| Cas Number | 830-96-6 |
| Molecular Formula | C11H9NO2 |
| Molecular Weight | 187.20 g/mol |
| Appearance | White to off-white powder |
| Melting Point | 153-156°C |
| Solubility | Slightly soluble in water, soluble in ethanol and DMSO |
| Purity | Typically ≥98% |
| Storage Temperature | 2-8°C |
| Synonyms | Indole-3-acrylic acid, 3-Indoleacrylic acid |
| Pka | 4.6 (carboxyl group) |
| Smiles | C1=CC=C2C(=C1)C=CN2C=CC(=O)O |
| Application | Intermediate in organic synthesis and research |
Akredite bir 3B-İndol Akrilik Asit fabrikası olarak, sıkı kalite protokolleri uyguluyoruz; her parti, tutarlı etkinlik ve güvenlik standartlarını sağlamak için titiz testlerden geçiyor.
| Packing | 100 - gram pack of 3 - Indole Acrylic Acid in air - tight, chemical - resistant packaging. |
| Storage | 3 - Indole Acrylic Acid should be stored in a cool, dry place, away from heat and direct sunlight. Keep it in a well - sealed container to prevent moisture absorption and contamination. Store it separately from oxidizing agents and incompatible substances. This helps maintain its chemical integrity and reduces the risk of degradation or dangerous reactions. |
| Shipping | 3 - Indole Acrylic Acid is shipped with strict adherence to chemical transport regulations. It's carefully packaged to prevent spills and damage, often in sealed containers. Shipment may involve temperature - controlled environments if required for stability. |
Bütçenize uygun rekabetçi 3B-İndol Akrilik Asit fiyatları—her sipariş için esnek koşullar ve özelleştirilmiş teklifler.
Numuneler, fiyatlandırma veya daha fazla bilgi için lütfen bizi arayın+8615365186327 veya mail atın sales3@ascent-chem.com.
Size en kısa sürede cevap vereceğiz.
Tel: +8615365186327
E-posta: sales3@ascent-chem.com
