|
HS Kodu |
514083 |
| Chemical Name | 3-Furanylacrylic Acid |
| Cas Number | 609-97-8 |
| Molecular Formula | C7H6O3 |
| Molecular Weight | 138.12 g/mol |
| Appearance | White to off-white solid |
| Melting Point | 148-150 °C |
| Solubility | Slightly soluble in water |
| Density | 1.371 g/cm3 |
| Pubchem Cid | 12611 |
| Smiles | C1=COC=C1C=CC(=O)O |
| Inchi | InChI=1S/C7H6O3/c8-7(9)3-6-2-1-5-10-6/h1-5H,(H,8,9) |
| Synonyms | 3-(Furan-3-yl)acrylic acid |
| Storage Conditions | Store at room temperature, tightly closed |
Akredite bir 3-Furanilakrilik Asit fabrikası olarak, sıkı kalite protokolleri uyguluyoruz; her parti, tutarlı etkinlik ve güvenlik standartlarını sağlamak için titiz testlerden geçiyor.
| Packing | 100g of 3 - Furanylacrylic Acid packaged in a sealed, air - tight plastic bag. |
| Storage | 3 - Furanylacrylic acid should be stored in a cool, dry place away from direct sunlight. Keep it in a well - sealed container to prevent moisture absorption and contact with air, which could potentially lead to degradation. Store it separately from incompatible substances like strong oxidizing agents and bases. Ideal storage temperature is around room temperature, avoiding extreme hot or cold conditions. |
| Shipping | 3 - Furanylacrylic Acid is shipped in sealed, corrosion - resistant containers. Packaging ensures protection from moisture and physical damage. Shipments follow strict chemical transportation regulations for safe delivery. |
Bütçenize uygun rekabetçi 3-Furanilakrilik Asit fiyatları—her sipariş için esnek koşullar ve özelleştirilmiş teklifler.
Numuneler, fiyatlandırma veya daha fazla bilgi için lütfen bizi arayın+8615365186327 veya mail atın sales3@ascent-chem.com.
Size en kısa sürede cevap vereceğiz.
Tel: +8615365186327
E-posta: sales3@ascent-chem.com
