|
HS Kodu |
831550 |
| Chemical Name | 3-Benzoylacrylic Acid |
| Cas Number | 614-61-9 |
| Molecular Formula | C10H8O3 |
| Molecular Weight | 176.17 |
| Appearance | White to off-white powder |
| Melting Point | 185-187°C |
| Solubility | Slightly soluble in water, soluble in organic solvents |
| Purity | Typically ≥98% |
| Storage Temperature | Store at 2-8°C |
| Synonyms | Benzalmalonic acid |
| Inchi | InChI=1S/C10H8O3/c11-9(7-8-4-2-1-3-5-8)6-10(12)13/h1-7H,(H,12,13) |
| Smiles | C1=CC=C(C=C1)C(=O)C=CC(=O)O |
| Assay Method | HPLC |
Akredite bir 3-Benzoylakrilik Asit fabrikası olarak, sıkı kalite protokolleri uyguluyoruz; her parti, tutarlı etkinlik ve güvenlik standartlarını sağlamak için titiz testlerden geçiyor.
| Packing | 100 - gram pack of 3 - Benzoylacrylic Acid in sealed, chemical - resistant packaging. |
| Storage | 3 - Benzoylacrylic acid should be stored in a cool, dry place away from heat sources and direct sunlight. Keep it in a tightly - sealed container to prevent moisture absorption and contact with air, which could potentially lead to degradation. Store it separately from incompatible substances like strong oxidizing agents and bases to avoid chemical reactions. |
| Shipping | 3-Benzoylacrylic Acid is shipped in well - sealed containers, often lined to prevent contact with external elements. Shipment follows strict chemical transport regulations to ensure safety during transit, safeguarding both handlers and the environment. |
Bütçenize uygun rekabetçi 3-Benzoylakrilik Asit fiyatları—her sipariş için esnek koşullar ve özelleştirilmiş teklifler.
Numuneler, fiyatlandırma veya daha fazla bilgi için lütfen bizi arayın+8615365186327 veya mail atın sales3@ascent-chem.com.
Size en kısa sürede cevap vereceğiz.
Tel: +8615365186327
E-posta: sales3@ascent-chem.com
