|
HS Kodu |
875699 |
| Productname | 3-(4-Chloro-3-Nitrophenyl)Acrylic Acid |
| Casnumber | 32727-66-3 |
| Molecularformula | C9H6ClNO4 |
| Molecularweight | 227.6 g/mol |
| Appearance | Yellow solid |
| Meltingpoint | 181-185 °C |
| Solubility | Slightly soluble in water |
| Purity | Typically ≥98% |
| Smiles | C1=CC(=C(C=C1Cl)N(=O)=O)C=CC(=O)O |
| Inchi | InChI=1S/C9H6ClNO4/c10-8-4-6(1-2-9(12)13)3-7(5-8)11(14)15/h1-5H,(H,12,13) |
| Storagetemperature | 2-8 °C |
| Synonyms | 4-Chloro-3-nitrocinnamic acid |
Akredite bir 3-(4-Kloro-3-Nitrofenil)Akrilik Asit fabrikası olarak, sıkı kalite protokolleri uyguluyoruz; her parti, tutarlı etkinlik ve güvenlik standartlarını sağlamak için titiz testlerden geçiyor.
| Packing | 100g of 3-(4 - Chloro - 3 - Nitrophenyl)Acrylic Acid packaged in a sealed plastic bag. |
| Storage | 3-(4 - Chloro - 3 - Nitrophenyl)Acrylic Acid should be stored in a cool, dry place, away from heat sources and direct sunlight. Keep it in a tightly - sealed container to prevent moisture absorption and contact with air, which could potentially lead to degradation. Store it separately from incompatible substances, such as strong oxidizing or reducing agents, to avoid chemical reactions. |
| Shipping | 3-(4 - Chloro - 3 - Nitrophenyl)Acrylic Acid is shipped in well - sealed, corrosion - resistant containers. Special handling precautions are taken due to its chemical nature, following strict regulations to ensure safe transportation. |
Bütçenize uygun rekabetçi 3-(4-Kloro-3-Nitrofenil)Akrilik Asit fiyatları—her sipariş için esnek koşullar ve özelleştirilmiş teklifler.
Numuneler, fiyatlandırma veya daha fazla bilgi için lütfen bizi arayın+8615365186327 veya mail atın sales3@ascent-chem.com.
Size en kısa sürede cevap vereceğiz.
Tel: +8615365186327
E-posta: sales3@ascent-chem.com
