|
HS Kodu |
485792 |
| Chemical Name | 3-(4-Chloro-2-Fluorophenyl)Acrylic Acid |
| Molecular Formula | C9H6ClFO2 |
| Molecular Weight | 200.6 g/mol |
| Cas Number | 870718-85-3 |
| Appearance | White to off-white solid |
| Purity | Typically ≥98% |
| Solubility | Soluble in organic solvents (e.g., DMSO, methanol) |
| Storage Conditions | Store at room temperature, away from moisture and light |
| Smiles | C1=CC(=C(C=C1Cl)F)C=CC(=O)O |
| Inchi | InChI=1S/C9H6ClFO2/c10-7-3-1-6(9(12)13)2-8(11)5-4-7/h1-5H,(H,12,13) |
Akredite bir 3-(4-Kloro-2-Florofenil)Akrilik Asit fabrikası olarak, sıkı kalite protokolleri uyguluyoruz; her parti, tutarlı etkinlik ve güvenlik standartlarını sağlamak için titiz testlerden geçiyor.
| Packing | 500g of 3-(4 - Chloro - 2 - Fluorophenyl)Acrylic Acid packaged in a sealed plastic bag. |
| Storage | 3-(4 - Chloro - 2 - Fluorophenyl)Acrylic Acid should be stored in a cool, dry place away from heat sources and direct sunlight. Keep it in a well - sealed container to prevent moisture absorption and contact with air, which could potentially lead to degradation. Store it separately from incompatible substances, like strong oxidizers or bases, to ensure safety and maintain its chemical integrity. |
| Shipping | 3-(4 - Chloro - 2 - fluorophenyl)acrylic acid is shipped in properly sealed containers. It follows strict chemical transportation regulations to ensure safe transit, avoiding exposure to incompatible substances. |
Bütçenize uygun rekabetçi 3-(4-Kloro-2-Florofenil)Akrilik Asit fiyatları—her sipariş için esnek koşullar ve özelleştirilmiş teklifler.
Numuneler, fiyatlandırma veya daha fazla bilgi için lütfen bizi arayın+8615365186327 veya mail atın sales3@ascent-chem.com.
Size en kısa sürede cevap vereceğiz.
Tel: +8615365186327
E-posta: sales3@ascent-chem.com
