|
HS Kodu |
167281 |
| Chemical Name | 3-(3-Pyridyl)acrylic acid |
| Molecular Formula | C8H7NO2 |
| Molecular Weight | 149.15 g/mol |
| Cas Number | 7406-77-9 |
| Appearance | White to off-white solid |
| Melting Point | 149-153°C |
| Solubility | Soluble in water and organic solvents |
| Smiles | C1=CC(=CN=C1)C=CC(=O)O |
| Inchi | InChI=1S/C8H7NO2/c10-8(11)4-3-7-2-1-5-9-6-7/h1-6H,(H,10,11) |
| Synonyms | beta-(3-Pyridyl)acrylic acid |
| Purity | Typically ≥98% |
| Storage Conditions | Store at room temperature in a dry place |
Akredite bir 3-(3-Piridil)Akrilik Asit fabrikası olarak, sıkı kalite protokolleri uyguluyoruz; her parti, tutarlı etkinlik ve güvenlik standartlarını sağlamak için titiz testlerden geçiyor.
| Packing | 500g of 3-(3 - Pyridyl)Acrylic Acid packaged in a sealed, chemical - resistant bag. |
| Storage | 3-(3 - Pyridyl)Acrylic Acid should be stored in a cool, dry place away from heat and ignition sources. Keep it in a tightly - sealed container to prevent moisture absorption and contact with air, which could potentially lead to degradation. Store it separately from incompatible substances like strong oxidizing agents and bases to ensure its stability and integrity over time. |
| Shipping | 3-(3 - Pyridyl)Acrylic Acid is shipped in well - sealed containers, safeguarded against physical damage. Transport follows strict chemical safety regulations, ensuring secure delivery to prevent any leakage or hazards during transit. |
Bütçenize uygun rekabetçi 3-(3-Piridil)Akrilik Asit fiyatları—her sipariş için esnek koşullar ve özelleştirilmiş teklifler.
Numuneler, fiyatlandırma veya daha fazla bilgi için lütfen bizi arayın+8615365186327 veya mail atın sales3@ascent-chem.com.
Size en kısa sürede cevap vereceğiz.
Tel: +8615365186327
E-posta: sales3@ascent-chem.com
