|
HS Kodu |
939731 |
| Product Name | 3-(3,4,5-Trimethoxyphenyl)Acrylic Acid Chloride |
| Cas Number | 82671-98-1 |
| Molecular Formula | C12H11ClO4 |
| Molecular Weight | 254.67 |
| Appearance | White to off-white solid |
| Purity | Typically ≥98% |
| Melting Point | 97-100°C (literature value) |
| Solubility | Slightly soluble in polar organic solvents |
| Storage Condition | Store at 2-8°C, protect from moisture |
| Synonyms | trans-3-(3,4,5-Trimethoxyphenyl)acryloyl chloride |
| Smiles | COC1=CC(=CC(=C1OC)OC)C=CC(=O)Cl |
| Inchikey | IFGUJOQGAIZIAT-UHFFFAOYSA-N |
| Reactivity | Reacts with water, alcohols, and amines |
| Hazard | Corrosive, causes burns to skin and eyes |
Akredite bir 3-(3,4,5-Trimetoksifenil)Akrilik Asit Klorür fabrikası olarak, sıkı kalite protokolleri uyguluyoruz; her parti, tutarlı etkinlik ve güvenlik standartlarını sağlamak için titiz testlerden geçiyor.
| Packing | |
| Storage | |
| Shipping |
Bütçenize uygun rekabetçi 3-(3,4,5-Trimetoksifenil)Akrilik Asit Klorür fiyatları—her sipariş için esnek koşullar ve özelleştirilmiş teklifler.
Numuneler, fiyatlandırma veya daha fazla bilgi için lütfen bizi arayın+8615365186327 veya mail atın sales3@ascent-chem.com.
Size en kısa sürede cevap vereceğiz.
Tel: +8615365186327
E-posta: sales3@ascent-chem.com
