|
HS Kodu |
838432 |
| Iupac Name | (2E)-3-(pyridin-3-yl)acrylic acid |
| Cas Number | 51762-05-9 |
| Molecular Formula | C8H7NO2 |
| Molecular Weight | 149.15 g/mol |
| Appearance | White to off-white solid |
| Melting Point | 165-167°C |
| Solubility In Water | Slightly soluble |
| Smiles | C1=CC(=CN=C1)/C=C/C(=O)O |
| Inchi | InChI=1S/C8H7NO2/c10-8(11)4-5-7-2-1-3-9-6-7/h1-6H,(H,10,11)/b5-4+ |
| Pubchem Cid | 166713 |
| Pka | 4.43 (carboxylic acid group) |
| Synonyms | β-(3-Pyridyl)acrylic acid; 3-Pyridylacrylic acid |
| Logp | 0.97 |
Akredite bir (2E)-3-(Piridin-3-Yl)Akrilik Asit fabrikası olarak, sıkı kalite protokolleri uyguluyoruz; her parti, tutarlı etkinlik ve güvenlik standartlarını sağlamak için titiz testlerden geçiyor.
| Packing | 500g of (2E)-3-(Pyridin-3-yl)acrylic acid in sealed, chemical - resistant bags. |
| Storage | (2E)-3-(Pyridin - 3 - yl)acrylic acid should be stored in a cool, dry place away from direct sunlight. Keep it in a well - sealed container to prevent contact with moisture and air, which could potentially lead to degradation. Store it separately from incompatible substances like strong oxidizing agents and bases to avoid chemical reactions. |
| Shipping | (2E)-3-(Pyridin-3-yl)acrylic acid is shipped in well - sealed containers, compliant with chemical transport regulations. Special care is taken to prevent damage, with proper cushioning and secure packaging for safe transit. |
Bütçenize uygun rekabetçi (2E)-3-(Piridin-3-Yl)Akrilik Asit fiyatları—her sipariş için esnek koşullar ve özelleştirilmiş teklifler.
Numuneler, fiyatlandırma veya daha fazla bilgi için lütfen bizi arayın+8615365186327 veya mail atın sales3@ascent-chem.com.
Size en kısa sürede cevap vereceğiz.
Tel: +8615365186327
E-posta: sales3@ascent-chem.com
