|
HS Kodu |
183118 |
| Iupac Name | (2E)-3-Ethoxyacrylic acid |
| Cas Number | 53521-53-8 |
| Molecular Formula | C5H8O3 |
| Molecular Weight | 116.12 g/mol |
| Appearance | Colorless to pale yellow liquid |
| Boiling Point | 92-94 °C at 20 mmHg |
| Density | 1.096 g/cm³ (approximate) |
| Solubility In Water | Moderately soluble |
| Smiles | CCOC=CC(=O)O |
| Inchi | InChI=1S/C5H8O3/c1-2-8-4-3-5(6)7/h3-4H,2H2,1H3,(H,6,7)/b4-3+ |
| Refractive Index | 1.440 (approximate) |
| Ec Number | 258-396-3 |
Akredite bir (2E)-3-Etoksiakrilik Asit fabrikası olarak, sıkı kalite protokolleri uyguluyoruz; her parti, tutarlı etkinlik ve güvenlik standartlarını sağlamak için titiz testlerden geçiyor.
| Packing | 500g of (2E)-3 - Ethoxyacrylic Acid in a sealed, corrosion - resistant plastic bottle. |
| Storage | (2E)-3 - Ethoxyacrylic acid should be stored in a cool, dry, well - ventilated area, away from heat sources and ignition points. Keep it in a tightly sealed container to prevent contact with air and moisture, which could potentially cause degradation. Store it separately from incompatible substances like strong oxidizing agents and bases to avoid chemical reactions. |
| Shipping | (2E)-3 - Ethoxyacrylic Acid is shipped in carefully sealed, corrosion - resistant containers. Shipment adheres to strict chemical transportation regulations, ensuring safe transit to prevent spills and maintain product integrity. |
Bütçenize uygun rekabetçi (2E)-3-Etoksiakrilik Asit fiyatları—her sipariş için esnek koşullar ve özelleştirilmiş teklifler.
Numuneler, fiyatlandırma veya daha fazla bilgi için lütfen bizi arayın+8615365186327 veya mail atın sales3@ascent-chem.com.
Size en kısa sürede cevap vereceğiz.
Tel: +8615365186327
E-posta: sales3@ascent-chem.com
