|
HS Kodu |
317786 |
| Iupac Name | (2E)-3-(5-nitrocyclohex-1-en-1-yl)acrylic acid |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Cas Number | 119224-15-6 |
| Appearance | Solid (exact color may vary, typically off-white to light yellow) |
| Solubility | Slightly soluble in water, more soluble in organic solvents |
| Boiling Point | Decomposes before boiling |
| Smiles | C1CC(=CC(C1)[N+](=O)[O-])C=CC(=O)O |
| Inchi | InChI=1S/C9H11NO4/c11-9(12)5-6-7-3-1-2-4-8(7)10(13)14/h5-6H,1-4H2,(H,11,12)/b6-5+ |
| Pubchem Cid | 20071461 |
| Storage Conditions | Store in a cool, dry place, away from light and incompatible substances |
| Functional Groups | Nitro, carboxylic acid, alkene, cyclohexene |
Akredite bir (2E)-3-(5-Nitrosikloheks-1-Enil)Akrilik Asit fabrikası olarak, sıkı kalite protokolleri uyguluyoruz; her parti, tutarlı etkinlik ve güvenlik standartlarını sağlamak için titiz testlerden geçiyor.
| Packing | Packaging: 1 kg of (2E)-3-(5 - Nitrocyclohex - 1 - enyl)acrylic acid in airtight container. |
| Storage | (2E)-3-(5-Nitrocyclohex-1-enyl)acrylic acid should be stored in a cool, dry place away from heat and direct sunlight. Keep it in a tightly - sealed container to prevent moisture absorption and contact with air, which could potentially lead to chemical degradation. Store it separately from incompatible substances like strong oxidizers and bases to ensure safety. |
| Shipping | (2E)-3-(5-Nitrocyclohex-1-enyl)acrylic acid is shipped in properly sealed, corrosion - resistant containers. Shipment adheres to strict chemical transport regulations, ensuring safety during transit. |
Bütçenize uygun rekabetçi (2E)-3-(5-Nitrosikloheks-1-Enil)Akrilik Asit fiyatları—her sipariş için esnek koşullar ve özelleştirilmiş teklifler.
Numuneler, fiyatlandırma veya daha fazla bilgi için lütfen bizi arayın+8615365186327 veya mail atın sales3@ascent-chem.com.
Size en kısa sürede cevap vereceğiz.
Tel: +8615365186327
E-posta: sales3@ascent-chem.com
