|
HS Kodu |
446265 |
| Iupac Name | (2E)-3-(4-chloro-3-nitrophenyl)acrylic acid |
| Molecular Formula | C9H6ClNO4 |
| Molecular Weight | 227.60 g/mol |
| Cas Number | 32726-82-8 |
| Appearance | Yellow crystalline powder |
| Melting Point | 220-222°C |
| Solubility | Slightly soluble in water; soluble in organic solvents like DMSO and methanol |
| Smiles | C1=CC(=C(C=C1Cl)[N+](=O)[O-])C=CC(=O)O |
| Inchi | InChI=1S/C9H6ClNO4/c10-7-3-1-6(9(12)13)2-8(7)11(14)15/h1-3H,(H,12,13)/b6-1+ |
| Purity | Typically ≥98% |
| Storage Temperature | 2-8°C, protected from light and moisture |
| Pka | 4.2 (for the carboxylic acid group) |
| Hazard Statements | H315, H319, H335 |
Akredite bir (2E)-3-(4-Kloro-3-Nitrofenil)Akrilik Asit fabrikası olarak, sıkı kalite protokolleri uyguluyoruz; her parti, tutarlı etkinlik ve güvenlik standartlarını sağlamak için titiz testlerden geçiyor.
| Packing | 500g of (2E)-3-(4 - Chloro - 3 - Nitrophenyl)Acrylic Acid in airtight chemical - grade packaging. |
| Storage | (2E)-3-(4 - Chloro - 3 - nitrophenyl)acrylic acid should be stored in a cool, dry place away from heat sources and direct sunlight. Keep it in a well - sealed container to prevent moisture absorption and contact with air. Store it separately from incompatible substances like strong oxidizers and bases to avoid potential reactions. |
| Shipping | (2E)-3-(4 - Chloro - 3 - nitrophenyl)acrylic acid is shipped in well - sealed, corrosion - resistant containers. It follows strict hazardous chemical shipping regulations to ensure safe transport due to its chemical nature. |
Bütçenize uygun rekabetçi (2E)-3-(4-Kloro-3-Nitrofenil)Akrilik Asit fiyatları—her sipariş için esnek koşullar ve özelleştirilmiş teklifler.
Numuneler, fiyatlandırma veya daha fazla bilgi için lütfen bizi arayın+8615365186327 veya mail atın sales3@ascent-chem.com.
Size en kısa sürede cevap vereceğiz.
Tel: +8615365186327
E-posta: sales3@ascent-chem.com
