|
HS Kodu |
475587 |
| Iupac Name | (2E)-3-(4-Bromo-2-chlorophenyl)acrylic acid |
| Molecular Formula | C9H6BrClO2 |
| Molecular Weight | 261.50 |
| Cas Number | 141995-96-2 |
| Appearance | Off-white to light brown solid |
| Melting Point | 173-176°C |
| Solubility In Water | Slightly soluble |
| Smiles | C1=CC(=C(C=C1C=CC(=O)O)Br)Cl |
| Inchi | InChI=1S/C9H6BrClO2/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1-5H,(H,12,13)/b4-2+ |
| Purity | Typically >98% |
| Storage Condition | Store at 2-8°C, protected from light |
Akredite bir (2E)-3-(4-Bromo-2-Klorofenil)Akrilik Asit fabrikası olarak, sıkı kalite protokolleri uyguluyoruz; her parti, tutarlı etkinlik ve güvenlik standartlarını sağlamak için titiz testlerden geçiyor.
| Packing | 500g of (2E)-3-(4 - Bromo - 2 - Chlorophenyl)Acrylic Acid in sealed, labeled containers. |
| Storage | (2E)-3-(4 - Bromo - 2 - Chlorophenyl)Acrylic Acid should be stored in a cool, dry place away from direct sunlight. Keep it in a well - sealed container to prevent moisture absorption and contact with air, which could potentially lead to degradation. Store it separately from incompatible substances, such as strong oxidizing agents or bases, to ensure its chemical stability. |
| Shipping | (2E)-3-(4 - Bromo - 2 - Chlorophenyl)Acrylic Acid is shipped in well - sealed, corrosion - resistant containers. It adheres to strict chemical transportation regulations, ensuring safety during transit to prevent spills and environmental exposure. |
Bütçenize uygun rekabetçi (2E)-3-(4-Bromo-2-Klorofenil)Akrilik Asit fiyatları—her sipariş için esnek koşullar ve özelleştirilmiş teklifler.
Numuneler, fiyatlandırma veya daha fazla bilgi için lütfen bizi arayın+8615365186327 veya mail atın sales3@ascent-chem.com.
Size en kısa sürede cevap vereceğiz.
Tel: +8615365186327
E-posta: sales3@ascent-chem.com
