|
HS Kodu |
699416 |
| Iupac Name | (2E)-3-(3-Methoxyphenyl)acrylic acid |
| Cas Number | 578-09-8 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 |
| Appearance | White to off-white crystalline powder |
| Melting Point | 164-168°C |
| Solubility In Water | Slightly soluble |
| Smiles | COC1=CC=CC(=C1)C=CC(=O)O |
| Inchi | InChI=1S/C10H10O3/c1-13-9-5-2-3-8(6-9)4-7-10(11)12/h2-7H,1H3,(H,11,12)/b7-4+ |
Akredite bir (2E)-3-(3-Metoksifenil)Akrilik Asit fabrikası olarak, sıkı kalite protokolleri uyguluyoruz; her parti, tutarlı etkinlik ve güvenlik standartlarını sağlamak için titiz testlerden geçiyor.
| Packing | 500g of (2E)-3-(3 - Methoxyphenyl)Acrylic Acid in a sealed, labeled chemical - grade container. |
| Storage | (2E)-3-(3 - Methoxyphenyl)acrylic acid should be stored in a cool, dry place away from heat and ignition sources. Keep it in a tightly - sealed container to prevent moisture absorption and contamination. Store it separately from oxidizing agents and bases, as it can react with them. Ideal storage temperature is around 2 - 8°C for long - term stability. |
| Shipping | (2E)-3-(3 - Methoxyphenyl)acrylic acid is shipped in well - sealed, corrosion - resistant containers. It adheres to strict chemical transportation regulations, ensuring safe transit to prevent any leakage or damage during shipping. |
Bütçenize uygun rekabetçi (2E)-3-(3-Metoksifenil)Akrilik Asit fiyatları—her sipariş için esnek koşullar ve özelleştirilmiş teklifler.
Numuneler, fiyatlandırma veya daha fazla bilgi için lütfen bizi arayın+8615365186327 veya mail atın sales3@ascent-chem.com.
Size en kısa sürede cevap vereceğiz.
Tel: +8615365186327
E-posta: sales3@ascent-chem.com