|
HS Kodu |
364388 |
| Iupac Name | (2E)-3-(3-chloro-4-fluorophenyl)prop-2-enoic acid |
| Cas Number | 885277-12-7 |
| Molecular Formula | C9H6ClFO2 |
| Molecular Weight | 200.59 |
| Appearance | White to off-white solid |
| Melting Point | 118-122°C |
| Solubility | Slightly soluble in water, soluble in organic solvents |
| Smiles | C1=CC(=C(C=C1C=CC(=O)O)Cl)F |
| Inchi | InChI=1S/C9H6ClFO2/c10-7-4-6(2-3-8(7)11)1-5-9(12)13/h1-5H,(H,12,13)/b5-1+ |
| Purity | Typically >98% |
| Storage Conditions | Store at 2-8°C, keep container tightly closed |
| Synonyms | 3-(3-chloro-4-fluorophenyl)acrylic acid |
Akredite bir (2E)-3-(3-Kloro-4-Florofenil)Akrilik Asit fabrikası olarak, sıkı kalite protokolleri uyguluyoruz; her parti, tutarlı etkinlik ve güvenlik standartlarını sağlamak için titiz testlerden geçiyor.
| Packing | 500g of (2E)-3-(3 - Chloro - 4 - Fluorophenyl)Acrylic Acid in sealed plastic bags. |
| Storage | (2E)-3-(3 - Chloro - 4 - fluorophenyl)acrylic acid should be stored in a cool, dry place, away from direct sunlight and heat sources. Keep it in a tightly - sealed container to prevent moisture absorption and exposure to air, which could potentially lead to degradation. Store it separately from incompatible substances, such as strong oxidizers or bases, to avoid chemical reactions. |
| Shipping | (2E)-3-(3 - Chloro - 4 - fluorophenyl)acrylic acid is shipped in accordance with chemical safety regulations. It's packaged securely to prevent leakage, transported by carriers experienced in handling such chemicals, ensuring proper storage during transit. |
Bütçenize uygun rekabetçi (2E)-3-(3-Kloro-4-Florofenil)Akrilik Asit fiyatları—her sipariş için esnek koşullar ve özelleştirilmiş teklifler.
Numuneler, fiyatlandırma veya daha fazla bilgi için lütfen bizi arayın+8615365186327 veya mail atın sales3@ascent-chem.com.
Size en kısa sürede cevap vereceğiz.
Tel: +8615365186327
E-posta: sales3@ascent-chem.com
