|
HS Kodu |
951926 |
| Iupac Name | (2E)-3-(3-Bromophenyl)acrylic acid |
| Molecular Formula | C9H7BrO2 |
| Molecular Weight | 227.06 g/mol |
| Cas Number | 55353-74-7 |
| Pubchem Cid | 3730911 |
| Appearance | White to light yellow solid |
| Melting Point | 172-174 °C |
| Solubility In Water | Slightly soluble |
| Smiles | C1=CC(=CC(=C1)Br)/C=C/C(=O)O |
| Inchi | InChI=1S/C9H7BrO2/c10-8-4-1-3-7(5-8)2-6-9(11)12/h1-6H,(H,11,12)/b6-2+ |
| Synonyms | m-Bromocinnamic acid |
| Storage Conditions | Store at 2-8°C, protected from light |
Akredite bir (2E)-3-(3-Bromofenil)Akrilik Asit fabrikası olarak, sıkı kalite protokolleri uyguluyoruz; her parti, tutarlı etkinlik ve güvenlik standartlarını sağlamak için titiz testlerden geçiyor.
| Packing | 100g of (2E)-3-(3 - Bromophenyl)Acrylic Acid in a sealed chemical - grade bag. |
| Storage | (2E)-3-(3 - Bromophenyl)acrylic acid should be stored in a cool, dry place away from heat and ignition sources. Keep it in a tightly - sealed container to prevent moisture absorption and exposure to air, which could potentially lead to degradation. Store it separately from incompatible substances like strong oxidizing agents to ensure safety. |
| Shipping | (2E)-3-(3-Bromophenyl)acrylic acid is shipped in well - sealed, corrosion - resistant containers. It's transported under regulated conditions, ensuring compliance with chemical safety regulations to prevent any damage or leakage during transit. |
Bütçenize uygun rekabetçi (2E)-3-(3-Bromofenil)Akrilik Asit fiyatları—her sipariş için esnek koşullar ve özelleştirilmiş teklifler.
Numuneler, fiyatlandırma veya daha fazla bilgi için lütfen bizi arayın+8615365186327 veya mail atın sales3@ascent-chem.com.
Size en kısa sürede cevap vereceğiz.
Tel: +8615365186327
E-posta: sales3@ascent-chem.com
